C18H22N4O8S — CID 19516216
2-O-ethyl 4-O-propyl 5-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19516216) has the molecular formula C18H22N4O8S and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-O-ethyl 4-O-propyl 5-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-propyl 5-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19516216 |
| Molecular Formula | C18H22N4O8S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-O-ethyl 4-O-propyl 5-[[2-(3-methoxy-4-nitropyrazol-1-yl)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)Cn2cc([N+](=O)[O-])c(OC)n2)sc(C(=O)OCC)c1C |
| InChI | InChI=1S/C18H22N4O8S/c1-5-7-30-17(24)13-10(3)14(18(25)29-6-2)31-16(13)19-12(23)9-21-8-11(22(26)27)15(20-21)28-4/h8H,5-7,9H2,1-4H3,(H,19,23) |
| InChIKey | ADLUUSSMVXCDJT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|