C17H20N4O7S — CID 19521250
2-O-methyl 4-O-propyl 3-methyl-5-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 19521250) has the molecular formula C17H20N4O7S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-O-methyl 4-O-propyl 3-methyl-5-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | 2-O-methyl 4-O-propyl 3-methyl-5-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19521250 |
| Molecular Formula | C17H20N4O7S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-O-methyl 4-O-propyl 3-methyl-5-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)Cn2nc([N+](=O)[O-])cc2C)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C17H20N4O7S/c1-5-6-28-16(23)13-10(3)14(17(24)27-4)29-15(13)18-12(22)8-20-9(2)7-11(19-20)21(25)26/h7H,5-6,8H2,1-4H3,(H,18,22) |
| InChIKey | BBWIWIMWKPVNSR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|