C18H23N5O6S — CID 19522449
propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 19522449) has the molecular formula C18H23N5O6S and a molecular weight of 437.48 g/mol. Its IUPAC name is propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19522449 |
| Molecular Formula | C18H23N5O6S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)Cn2ncc([N+](=O)[O-])c2C)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C18H23N5O6S/c1-6-7-29-18(26)14-10(2)15(17(25)21(4)5)30-16(14)20-13(24)9-22-11(3)12(8-19-22)23(27)28/h8H,6-7,9H2,1-5H3,(H,20,24) |
| InChIKey | ISQQARKOYNPRGL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|