C8H8N10O9 — CID 122380424
1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine (PubChem CID 122380424) has the molecular formula C8H8N10O9 and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine.
| Compound Name | 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine |
|---|---|
| PubChem CID | 122380424 |
| Molecular Formula | C8H8N10O9 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine |
| SMILES | Nc1c([N+](=O)[O-])nn(COCn2nc([N+](=O)[O-])c(N)c2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N10O9/c9-3-5(15(19)20)11-13(7(3)17(23)24)1-27-2-14-8(18(25)26)4(10)6(12-14)16(21)22/h1-2,9-10H2 |
| InChIKey | WSCOXIKTQPBDRQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 269.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|