About 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine
1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine (PubChem CID 122380424) has the molecular formula C8H8N10O9
and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine |
| PubChem CID | 122380424 |
| Molecular Formula | C8H8N10O9 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine |
| SMILES | Nc1c([N+](=O)[O-])nn(COCn2nc([N+](=O)[O-])c(N)c2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N10O9/c9-3-5(15(19)20)11-13(7(3)17(23)24)1-27-2-14-8(18(25)26)4(10)6(12-14)16(21)22/h1-2,9-10H2 |
| InChIKey | WSCOXIKTQPBDRQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 269.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine?
The IUPAC name of 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine (CID 122380424) is 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine.
What is the SMILES notation for 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine?
The canonical SMILES for 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine is Nc1c([N+](=O)[O-])nn(COCn2nc([N+](=O)[O-])c(N)c2[N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine?
The InChIKey is WSCOXIKTQPBDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N10O9/c9-3-5(15(19)20)11-13(7(3)17(23)24)1-27-2-14-8(18(25)26)4(10)6(12-14)16(21)22/h1-2,9-10H2.
What are the key properties of 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine?
1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine has a molecular weight of 388.21 g/mol, XLogP of -0.49, 8 rotatable bonds, 2 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-3,5-dinitropyrazol-1-yl)methoxymethyl]-3,5-dinitropyrazol-4-amine is sourced from PubChem (CID 122380424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).