C2H4N6O2 — CID 132533423
5-nitrotriazole-1,4-diamine (PubChem CID 132533423) has the molecular formula C2H4N6O2 and a molecular weight of 144.09 g/mol. Its IUPAC name is 5-nitrotriazole-1,4-diamine.
| Compound Name | 5-nitrotriazole-1,4-diamine |
|---|---|
| PubChem CID | 132533423 |
| Molecular Formula | C2H4N6O2 |
| Molecular Weight | 144.09 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-nitrotriazole-1,4-diamine |
| SMILES | Nc1nnn(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C2H4N6O2/c3-1-2(8(9)10)7(4)6-5-1/h3-4H2 |
| InChIKey | GWUYDAOMZMLQJJ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.09 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|