About hydroxylamine;2-hydroxy-5-nitrotetrazole
hydroxylamine;2-hydroxy-5-nitrotetrazole (PubChem CID 175730061) has the molecular formula CH4N6O4
and a molecular weight of 164.08 g/mol. Its IUPAC name is hydroxylamine;2-hydroxy-5-nitrotetrazole.
Molecular Properties
| Compound Name | hydroxylamine;2-hydroxy-5-nitrotetrazole |
| PubChem CID | 175730061 |
| Molecular Formula | CH4N6O4 |
| Molecular Weight | 164.08 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | hydroxylamine;2-hydroxy-5-nitrotetrazole |
| SMILES | NO.O=[N+]([O-])c1nnn(O)n1 |
| InChI | InChI=1S/CHN5O3.H3NO/c7-5(8)1-2-4-6(9)3-1;1-2/h9H;2H,1H2 |
| InChIKey | LKWWUCJPJQEMCJ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.08 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;2-hydroxy-5-nitrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;2-hydroxy-5-nitrotetrazole?
The IUPAC name of hydroxylamine;2-hydroxy-5-nitrotetrazole (CID 175730061) is hydroxylamine;2-hydroxy-5-nitrotetrazole.
What is the SMILES notation for hydroxylamine;2-hydroxy-5-nitrotetrazole?
The canonical SMILES for hydroxylamine;2-hydroxy-5-nitrotetrazole is NO.O=[N+]([O-])c1nnn(O)n1.
What is the InChIKey of hydroxylamine;2-hydroxy-5-nitrotetrazole?
The InChIKey is LKWWUCJPJQEMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CHN5O3.H3NO/c7-5(8)1-2-4-6(9)3-1;1-2/h9H;2H,1H2.
What are the key properties of hydroxylamine;2-hydroxy-5-nitrotetrazole?
hydroxylamine;2-hydroxy-5-nitrotetrazole has a molecular weight of 164.08 g/mol, XLogP of -1.85, 1 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;2-hydroxy-5-nitrotetrazole is sourced from PubChem (CID 175730061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).