C7H9N9O3 — CID 63578868
1-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 63578868) has the molecular formula C7H9N9O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63578868 |
| Molecular Formula | C7H9N9O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCn2cnc([N+](=O)[O-])n2)nn1 |
| InChI | InChI=1S/C7H9N9O3/c8-10-6(17)5-3-14(13-11-5)1-2-15-4-9-7(12-15)16(18)19/h3-4H,1-2,8H2,(H,10,17) |
| InChIKey | FOKATDZQVHDJSW-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|