C3H4N6O4 — CID 132533422
2,4-dinitroimidazole-1,5-diamine (PubChem CID 132533422) has the molecular formula C3H4N6O4 and a molecular weight of 188.10 g/mol. Its IUPAC name is 2,4-dinitroimidazole-1,5-diamine.
| Compound Name | 2,4-dinitroimidazole-1,5-diamine |
|---|---|
| PubChem CID | 132533422 |
| Molecular Formula | C3H4N6O4 |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2,4-dinitroimidazole-1,5-diamine |
| SMILES | Nc1c([N+](=O)[O-])nc([N+](=O)[O-])n1N |
| InChI | InChI=1S/C3H4N6O4/c4-1-2(8(10)11)6-3(7(1)5)9(12)13/h4-5H2 |
| InChIKey | PKTHNGFRUJWGCH-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 156.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|