About 2-nitroquinolin-3-amine
2-nitroquinolin-3-amine (PubChem CID 19034749) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-nitroquinolin-3-amine.
Molecular Properties
| Compound Name | 2-nitroquinolin-3-amine |
| PubChem CID | 19034749 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2-nitroquinolin-3-amine |
| SMILES | Nc1cc2ccccc2nc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N3O2/c10-7-5-6-3-1-2-4-8(6)11-9(7)12(13)14/h1-5H,10H2 |
| InChIKey | WLRYENIHLPMXMO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroquinolin-3-amine?
The IUPAC name of 2-nitroquinolin-3-amine (CID 19034749) is 2-nitroquinolin-3-amine.
What is the SMILES notation for 2-nitroquinolin-3-amine?
The canonical SMILES for 2-nitroquinolin-3-amine is Nc1cc2ccccc2nc1[N+](=O)[O-].
What is the InChIKey of 2-nitroquinolin-3-amine?
The InChIKey is WLRYENIHLPMXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c10-7-5-6-3-1-2-4-8(6)11-9(7)12(13)14/h1-5H,10H2.
What are the key properties of 2-nitroquinolin-3-amine?
2-nitroquinolin-3-amine has a molecular weight of 189.17 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroquinolin-3-amine is sourced from PubChem (CID 19034749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).