C8H4N12O12-2 — CID 177445173
[1-[2-(3,4-dinitro-5-nitroazanidylpyrazol-1-yl)ethyl]-3,4-dinitropyrazol-5-yl]-nitroazanide (PubChem CID 177445173) has the molecular formula C8H4N12O12-2 and a molecular weight of 460.19 g/mol. Its IUPAC name is [1-[2-(3,4-dinitro-5-nitroazanidylpyrazol-1-yl)ethyl]-3,4-dinitropyrazol-5-yl]-nitroazanide.
| Compound Name | [1-[2-(3,4-dinitro-5-nitroazanidylpyrazol-1-yl)ethyl]-3,4-dinitropyrazol-5-yl]-nitroazanide |
|---|---|
| PubChem CID | 177445173 |
| Molecular Formula | C8H4N12O12-2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | [1-[2-(3,4-dinitro-5-nitroazanidylpyrazol-1-yl)ethyl]-3,4-dinitropyrazol-5-yl]-nitroazanide |
| SMILES | O=[N+]([O-])[N-]c1c([N+](=O)[O-])c([N+](=O)[O-])nn1CCn1nc([N+](=O)[O-])c([N+](=O)[O-])c1[N-][N+](=O)[O-] |
| InChI | InChI=1S/C8H4N12O12/c21-15(22)3-5(11-19(29)30)13(9-7(3)17(25)26)1-2-14-6(12-20(31)32)4(16(23)24)8(10-14)18(27)28/h1-2H2/q-2 |
| InChIKey | XBQULQQKNXUQPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 322.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|