C13H9Cl2F3N4O3 — CID 19524213
N-(2,6-dichlorophenyl)-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19524213) has the molecular formula C13H9Cl2F3N4O3 and a molecular weight of 397.14 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19524213 |
| Molecular Formula | C13H9Cl2F3N4O3 |
| Molecular Weight | 397.14 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9Cl2F3N4O3/c1-6-11(22(24)25)12(13(16,17)18)20-21(6)5-9(23)19-10-7(14)3-2-4-8(10)15/h2-4H,5H2,1H3,(H,19,23) |
| InChIKey | YAPDPKAKXWAHKP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|