C13H20N4O4 — CID 27852183
(2S)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one (PubChem CID 27852183) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2S)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | (2S)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 27852183 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2S)-1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one |
| SMILES | Cc1nn([C@@H](C)C(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O4/c1-8-5-15(6-9(2)21-8)13(18)11(4)16-7-12(17(19)20)10(3)14-16/h7-9,11H,5-6H2,1-4H3/t8-,9+,11-/m0/s1 |
| InChIKey | YPJCFGLSLLYLPM-NGZCFLSTSA-N |
| XLogP | 1.30 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|