C21H30N8O6 — CID 19540018
ethyl 4-[2-[3-methyl-4-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19540018) has the molecular formula C21H30N8O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is ethyl 4-[2-[3-methyl-4-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[3-methyl-4-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19540018 |
| Molecular Formula | C21H30N8O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | ethyl 4-[2-[3-methyl-4-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=O)CCn3cc([N+](=O)[O-])c(C)n3)c(C)n2)CC1 |
| InChI | InChI=1S/C21H30N8O6/c1-5-35-21(32)26-10-8-25(9-11-26)20(31)16(4)28-12-17(14(2)24-28)22-19(30)6-7-27-13-18(29(33)34)15(3)23-27/h12-13,16H,5-11H2,1-4H3,(H,22,30) |
| InChIKey | VCTSENVNBLMMME-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 157.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|