C20H28N8O6 — CID 19530718
ethyl 4-[2-[3-methyl-4-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19530718) has the molecular formula C20H28N8O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is ethyl 4-[2-[3-methyl-4-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[3-methyl-4-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19530718 |
| Molecular Formula | C20H28N8O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl 4-[2-[3-methyl-4-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=O)Cn3nc(C)cc3[N+](=O)[O-])c(C)n2)CC1 |
| InChI | InChI=1S/C20H28N8O6/c1-5-34-20(31)25-8-6-24(7-9-25)19(30)15(4)26-11-16(14(3)23-26)21-17(29)12-27-18(28(32)33)10-13(2)22-27/h10-11,15H,5-9,12H2,1-4H3,(H,21,29) |
| InChIKey | SFRMFAGIQXLOEC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 157.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|