C21H27N11O6 — CID 19271619
ethyl 4-[2-[3-methyl-4-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19271619) has the molecular formula C21H27N11O6 and a molecular weight of 529.52 g/mol. Its IUPAC name is ethyl 4-[2-[3-methyl-4-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[3-methyl-4-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19271619 |
| Molecular Formula | C21H27N11O6 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | ethyl 4-[2-[3-methyl-4-[[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=O)c3ccn(Cn4cnc([N+](=O)[O-])n4)n3)c(C)n2)CC1 |
| InChI | InChI=1S/C21H27N11O6/c1-4-38-21(35)28-9-7-27(8-10-28)19(34)15(3)31-11-17(14(2)24-31)23-18(33)16-5-6-29(25-16)13-30-12-22-20(26-30)32(36)37/h5-6,11-12,15H,4,7-10,13H2,1-3H3,(H,23,33) |
| InChIKey | OKAUDNITAQDQCL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 188.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|