C26H30N6O8 — CID 19340956
ethyl 4-[2-[3-methyl-4-[[5-[(4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19340956) has the molecular formula C26H30N6O8 and a molecular weight of 554.56 g/mol. Its IUPAC name is ethyl 4-[2-[3-methyl-4-[[5-[(4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[3-methyl-4-[[5-[(4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19340956 |
| Molecular Formula | C26H30N6O8 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | ethyl 4-[2-[3-methyl-4-[[5-[(4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=O)c3ccc(COc4ccc([N+](=O)[O-])cc4)o3)c(C)n2)CC1 |
| InChI | InChI=1S/C26H30N6O8/c1-4-38-26(35)30-13-11-29(12-14-30)25(34)18(3)31-15-22(17(2)28-31)27-24(33)23-10-9-21(40-23)16-39-20-7-5-19(6-8-20)32(36)37/h5-10,15,18H,4,11-14,16H2,1-3H3,(H,27,33) |
| InChIKey | UJEHYHHPFZVIDH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|