C23H32N6O3S — CID 19447669
ethyl 4-[2-[4-[(4-ethylphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19447669) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is ethyl 4-[2-[4-[(4-ethylphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-[(4-ethylphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19447669 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | ethyl 4-[2-[4-[(4-ethylphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=S)Nc3ccc(CC)cc3)c(C)n2)CC1 |
| InChI | InChI=1S/C23H32N6O3S/c1-5-18-7-9-19(10-8-18)24-22(33)25-20-15-29(26-16(20)3)17(4)21(30)27-11-13-28(14-12-27)23(31)32-6-2/h7-10,15,17H,5-6,11-14H2,1-4H3,(H2,24,25,33) |
| InChIKey | RFNIIEUYXNRKOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|