C22H30N6O3S — CID 19447639
ethyl 4-[2-[4-(benzylcarbamothioylamino)-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19447639) has the molecular formula C22H30N6O3S and a molecular weight of 458.59 g/mol. Its IUPAC name is ethyl 4-[2-[4-(benzylcarbamothioylamino)-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(benzylcarbamothioylamino)-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19447639 |
| Molecular Formula | C22H30N6O3S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | ethyl 4-[2-[4-(benzylcarbamothioylamino)-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=S)NCc3ccccc3)c(C)n2)CC1 |
| InChI | InChI=1S/C22H30N6O3S/c1-4-31-22(30)27-12-10-26(11-13-27)20(29)17(3)28-15-19(16(2)25-28)24-21(32)23-14-18-8-6-5-7-9-18/h5-9,15,17H,4,10-14H2,1-3H3,(H2,23,24,32) |
| InChIKey | WRONDSXVRWNMCY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|