C22H30N6O4S — CID 19447642
ethyl 4-[2-[4-[(2-methoxyphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate (PubChem CID 19447642) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is ethyl 4-[2-[4-[(2-methoxyphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-[(2-methoxyphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19447642 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | ethyl 4-[2-[4-[(2-methoxyphenyl)carbamothioylamino]-3-methylpyrazol-1-yl]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(C)n2cc(NC(=S)Nc3ccccc3OC)c(C)n2)CC1 |
| InChI | InChI=1S/C22H30N6O4S/c1-5-32-22(30)27-12-10-26(11-13-27)20(29)16(3)28-14-18(15(2)25-28)24-21(33)23-17-8-6-7-9-19(17)31-4/h6-9,14,16H,5,10-13H2,1-4H3,(H2,23,24,33) |
| InChIKey | KSOVSBIJFKAICJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|