C18H27N7O3 — CID 19540253
1-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]-2-methyl-3-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 19540253) has the molecular formula C18H27N7O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]-2-methyl-3-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]-2-methyl-3-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19540253 |
| Molecular Formula | C18H27N7O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[4-[(1-ethyl-3-methylpyrazol-4-yl)methyl]piperazin-1-yl]-2-methyl-3-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | CCn1cc(CN2CCN(C(=O)C(C)Cn3cc([N+](=O)[O-])cn3)CC2)c(C)n1 |
| InChI | InChI=1S/C18H27N7O3/c1-4-23-12-16(15(3)20-23)11-21-5-7-22(8-6-21)18(26)14(2)10-24-13-17(9-19-24)25(27)28/h9,12-14H,4-8,10-11H2,1-3H3 |
| InChIKey | NSPMCANUQWVYRP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|