C18H22N5O5+ — CID 7353064
(2S)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 7353064) has the molecular formula C18H22N5O5+ and a molecular weight of 388.40 g/mol. Its IUPAC name is (2S)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | (2S)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 7353064 |
| Molecular Formula | C18H22N5O5+ |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (2S)-1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-2-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | C[C@@H](C(=O)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C18H21N5O5/c1-13(22-11-15(9-19-22)23(25)26)18(24)21-6-4-20(5-7-21)10-14-2-3-16-17(8-14)28-12-27-16/h2-3,8-9,11,13H,4-7,10,12H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | DTIHCFXULUEVIL-ZDUSSCGKSA-O |
| XLogP | 0.01 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|