C19H16F5N2O3+ — CID 7310180
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 7310180) has the molecular formula C19H16F5N2O3+ and a molecular weight of 415.34 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 7310180 |
| Molecular Formula | C19H16F5N2O3+ |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H15F5N2O3/c20-14-13(15(21)17(23)18(24)16(14)22)19(27)26-5-3-25(4-6-26)8-10-1-2-11-12(7-10)29-9-28-11/h1-2,7H,3-6,8-9H2/p+1 |
| InChIKey | SSRWFYGZWZONNR-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|