C15H21N7O5S — CID 19536645
2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 19536645) has the molecular formula C15H21N7O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19536645 |
| Molecular Formula | C15H21N7O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(1-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | Cc1c([N+](=O)[O-])cnn1C(C)C(=O)N1CCN(S(=O)(=O)c2cnn(C)c2)CC1 |
| InChI | InChI=1S/C15H21N7O5S/c1-11-14(22(24)25)9-17-21(11)12(2)15(23)19-4-6-20(7-5-19)28(26,27)13-8-16-18(3)10-13/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | WJLUQXOXDPSDJM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|