C16H21N5O4S — CID 133340791
N-(4-methyl-2-nitrophenyl)-1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-amine (PubChem CID 133340791) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(4-methyl-2-nitrophenyl)-1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-amine.
| Compound Name | N-(4-methyl-2-nitrophenyl)-1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 133340791 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(4-methyl-2-nitrophenyl)-1-(1-methylpyrazol-4-yl)sulfonylpiperidin-4-amine |
| SMILES | Cc1ccc(NC2CCN(S(=O)(=O)c3cnn(C)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N5O4S/c1-12-3-4-15(16(9-12)21(22)23)18-13-5-7-20(8-6-13)26(24,25)14-10-17-19(2)11-14/h3-4,9-11,13,18H,5-8H2,1-2H3 |
| InChIKey | LPWPUSBFJBMIBZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|