C17H22N6O3 — CID 19574201
2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-1-one (PubChem CID 19574201) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19574201 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(5-methyl-4-nitropyrazol-1-yl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1c([N+](=O)[O-])cnn1C(C)C(=O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C17H22N6O3/c1-13-16(23(25)26)11-19-22(13)14(2)17(24)21-8-6-20(7-9-21)12-15-4-3-5-18-10-15/h3-5,10-11,14H,6-9,12H2,1-2H3 |
| InChIKey | ZDODWLMMGYLLOI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|