C18H14N4O3S — CID 175272073
[3-[5-amino-6-(1,3-benzoxazol-2-yl)pyrazin-2-yl]phenyl]methanesulfinic acid (PubChem CID 175272073) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is [3-[5-amino-6-(1,3-benzoxazol-2-yl)pyrazin-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [3-[5-amino-6-(1,3-benzoxazol-2-yl)pyrazin-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 175272073 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [3-[5-amino-6-(1,3-benzoxazol-2-yl)pyrazin-2-yl]phenyl]methanesulfinic acid |
| SMILES | Nc1ncc(-c2cccc(CS(=O)O)c2)nc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H14N4O3S/c19-17-16(18-22-13-6-1-2-7-15(13)25-18)21-14(9-20-17)12-5-3-4-11(8-12)10-26(23)24/h1-9H,10H2,(H2,19,20)(H,23,24) |
| InChIKey | MDXHNGUTONRNIS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|