C15H14N2O2S — CID 81304611
[2-(1,3-benzoxazol-2-ylsulfanyl)-4-methoxyphenyl]methanamine (PubChem CID 81304611) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-ylsulfanyl)-4-methoxyphenyl]methanamine.
| Compound Name | [2-(1,3-benzoxazol-2-ylsulfanyl)-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 81304611 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [2-(1,3-benzoxazol-2-ylsulfanyl)-4-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN)c(Sc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C15H14N2O2S/c1-18-11-7-6-10(9-16)14(8-11)20-15-17-12-4-2-3-5-13(12)19-15/h2-8H,9,16H2,1H3 |
| InChIKey | HHMQGHALZLKVKC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |