C19H20N2O4S — CID 23970274
2-(1,3-benzoxazol-2-ylsulfanyl)-N-(2,4-dimethoxyphenyl)butanamide (PubChem CID 23970274) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(2,4-dimethoxyphenyl)butanamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(2,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 23970274 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(2,4-dimethoxyphenyl)butanamide |
| SMILES | CCC(Sc1nc2ccccc2o1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H20N2O4S/c1-4-17(26-19-21-13-7-5-6-8-15(13)25-19)18(22)20-14-10-9-12(23-2)11-16(14)24-3/h5-11,17H,4H2,1-3H3,(H,20,22) |
| InChIKey | ZBGOIYGJLXYQPA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |