C15H8O3 — CID 10728490
11-methyl-8-oxatetracyclo[7.6.0.02,7.012,15]pentadeca-1(9),2,4,6,10,12(15)-hexaene-13,14-dione (PubChem CID 10728490) has the molecular formula C15H8O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 11-methyl-8-oxatetracyclo[7.6.0.02,7.012,15]pentadeca-1(9),2,4,6,10,12(15)-hexaene-13,14-dione.
| Compound Name | 11-methyl-8-oxatetracyclo[7.6.0.02,7.012,15]pentadeca-1(9),2,4,6,10,12(15)-hexaene-13,14-dione |
|---|---|
| PubChem CID | 10728490 |
| Molecular Formula | C15H8O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 11-methyl-8-oxatetracyclo[7.6.0.02,7.012,15]pentadeca-1(9),2,4,6,10,12(15)-hexaene-13,14-dione |
| SMILES | Cc1cc2oc3ccccc3c2c2c(=O)c(=O)c12 |
| InChI | InChI=1S/C15H8O3/c1-7-6-10-12(13-11(7)14(16)15(13)17)8-4-2-3-5-9(8)18-10/h2-6H,1H3 |
| InChIKey | ZEMVRYGVXVQAII-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|