C16H13NO2 — CID 143912464
8,9-bis(ethenyl)-4-methyl-7H-pyrano[2,3-e]indol-2-one (PubChem CID 143912464) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 8,9-bis(ethenyl)-4-methyl-7H-pyrano[2,3-e]indol-2-one.
| Compound Name | 8,9-bis(ethenyl)-4-methyl-7H-pyrano[2,3-e]indol-2-one |
|---|---|
| PubChem CID | 143912464 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 8,9-bis(ethenyl)-4-methyl-7H-pyrano[2,3-e]indol-2-one |
| SMILES | C=Cc1[nH]c2ccc3c(C)cc(=O)oc3c2c1C=C |
| InChI | InChI=1S/C16H13NO2/c1-4-10-12(5-2)17-13-7-6-11-9(3)8-14(18)19-16(11)15(10)13/h4-8,17H,1-2H2,3H3 |
| InChIKey | GLZGTFAHMANXSG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|