C22H27NS — CID 144512484
ethane;2,3,7,8-tetrakis(ethenyl)-6H-thieno[2,3-e]indole (PubChem CID 144512484) has the molecular formula C22H27NS and a molecular weight of 337.53 g/mol. Its IUPAC name is ethane;2,3,7,8-tetrakis(ethenyl)-6H-thieno[2,3-e]indole.
| Compound Name | ethane;2,3,7,8-tetrakis(ethenyl)-6H-thieno[2,3-e]indole |
|---|---|
| PubChem CID | 144512484 |
| Molecular Formula | C22H27NS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethane;2,3,7,8-tetrakis(ethenyl)-6H-thieno[2,3-e]indole |
| SMILES | C=Cc1[nH]c2ccc3c(C=C)c(C=C)sc3c2c1C=C.CC.CC |
| InChI | InChI=1S/C18H15NS.2C2H6/c1-5-11-13-9-10-15-17(18(13)20-16(11)8-4)12(6-2)14(7-3)19-15;2*1-2/h5-10,19H,1-4H2;2*1-2H3 |
| InChIKey | ZDPHNWCWNVUMDL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |