C27H24N2O — CID 145243666
(Z)-[(19Z)-15,16-bis(ethenyl)-22,22-dimethyl-9,17-diazapentacyclo[11.9.0.02,10.03,8.014,18]docosa-1(13),2(10),3,5,7,11,14(18),15,19-nonaen-21-ylidene]methanol (PubChem CID 145243666) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is (Z)-[(19Z)-15,16-bis(ethenyl)-22,22-dimethyl-9,17-diazapentacyclo[11.9.0.02,10.03,8.014,18]docosa-1(13),2(10),3,5,7,11,14(18),15,19-nonaen-21-ylidene]methanol.
| Compound Name | (Z)-[(19Z)-15,16-bis(ethenyl)-22,22-dimethyl-9,17-diazapentacyclo[11.9.0.02,10.03,8.014,18]docosa-1(13),2(10),3,5,7,11,14(18),15,19-nonaen-21-ylidene]methanol |
|---|---|
| PubChem CID | 145243666 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (Z)-[(19Z)-15,16-bis(ethenyl)-22,22-dimethyl-9,17-diazapentacyclo[11.9.0.02,10.03,8.014,18]docosa-1(13),2(10),3,5,7,11,14(18),15,19-nonaen-21-ylidene]methanol |
| SMILES | C=Cc1[nH]c2c(c1C=C)-c1ccc3[nH]c4ccccc4c3c1C(C)(C)C(=C\O)/C=C\2 |
| InChI | InChI=1S/C27H24N2O/c1-5-17-20(6-2)28-22-13-11-16(15-30)27(3,4)26-19(24(17)22)12-14-23-25(26)18-9-7-8-10-21(18)29-23/h5-15,28-30H,1-2H2,3-4H3/b13-11-,16-15- |
| InChIKey | BMXQWDPSCHPFIS-DURLKXOLSA-N |
| XLogP | 7.35 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|