About 3-ethyl-9H-carbazol-4-ol
3-ethyl-9H-carbazol-4-ol (PubChem CID 163569607) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-ethyl-9H-carbazol-4-ol.
Molecular Properties
| Compound Name | 3-ethyl-9H-carbazol-4-ol |
| PubChem CID | 163569607 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-ethyl-9H-carbazol-4-ol |
| SMILES | CCc1ccc2[nH]c3ccccc3c2c1O |
| InChI | InChI=1S/C14H13NO/c1-2-9-7-8-12-13(14(9)16)10-5-3-4-6-11(10)15-12/h3-8,15-16H,2H2,1H3 |
| InChIKey | FYEHWRSTTXCQDG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-9H-carbazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9H-carbazol-4-ol?
The IUPAC name of 3-ethyl-9H-carbazol-4-ol (CID 163569607) is 3-ethyl-9H-carbazol-4-ol.
What is the SMILES notation for 3-ethyl-9H-carbazol-4-ol?
The canonical SMILES for 3-ethyl-9H-carbazol-4-ol is CCc1ccc2[nH]c3ccccc3c2c1O.
What is the InChIKey of 3-ethyl-9H-carbazol-4-ol?
The InChIKey is FYEHWRSTTXCQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO/c1-2-9-7-8-12-13(14(9)16)10-5-3-4-6-11(10)15-12/h3-8,15-16H,2H2,1H3.
What are the key properties of 3-ethyl-9H-carbazol-4-ol?
3-ethyl-9H-carbazol-4-ol has a molecular weight of 211.26 g/mol, XLogP of 3.59, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9H-carbazol-4-ol is sourced from PubChem (CID 163569607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).