C11H6N2O4 — CID 131853462
1,4-dihydropyrano[3,2-f]quinoxaline-2,3,8-trione (PubChem CID 131853462) has the molecular formula C11H6N2O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is 1,4-dihydropyrano[3,2-f]quinoxaline-2,3,8-trione.
| Compound Name | 1,4-dihydropyrano[3,2-f]quinoxaline-2,3,8-trione |
|---|---|
| PubChem CID | 131853462 |
| Molecular Formula | C11H6N2O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1,4-dihydropyrano[3,2-f]quinoxaline-2,3,8-trione |
| SMILES | O=c1ccc2c(ccc3[nH]c(=O)c(=O)[nH]c32)o1 |
| InChI | InChI=1S/C11H6N2O4/c14-8-4-1-5-7(17-8)3-2-6-9(5)13-11(16)10(15)12-6/h1-4H,(H,12,15)(H,13,16) |
| InChIKey | CBCJZHQPGNNCLF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|