C14H8N2O3 — CID 102218797
2-(furan-2-yl)-3H-pyrano[3,2-e]benzimidazol-7-one (PubChem CID 102218797) has the molecular formula C14H8N2O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-(furan-2-yl)-3H-pyrano[3,2-e]benzimidazol-7-one.
| Compound Name | 2-(furan-2-yl)-3H-pyrano[3,2-e]benzimidazol-7-one |
|---|---|
| PubChem CID | 102218797 |
| Molecular Formula | C14H8N2O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(furan-2-yl)-3H-pyrano[3,2-e]benzimidazol-7-one |
| SMILES | O=c1ccc2c(ccc3[nH]c(-c4ccco4)nc32)o1 |
| InChI | InChI=1S/C14H8N2O3/c17-12-6-3-8-10(19-12)5-4-9-13(8)16-14(15-9)11-2-1-7-18-11/h1-7H,(H,15,16) |
| InChIKey | CGERLYFGSXVVJR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|