C12H11N3O — CID 104721099
[2-(furan-2-yl)-1H-benzimidazol-4-yl]methanamine (PubChem CID 104721099) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is [2-(furan-2-yl)-1H-benzimidazol-4-yl]methanamine.
| Compound Name | [2-(furan-2-yl)-1H-benzimidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 104721099 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [2-(furan-2-yl)-1H-benzimidazol-4-yl]methanamine |
| SMILES | NCc1cccc2[nH]c(-c3ccco3)nc12 |
| InChI | InChI=1S/C12H11N3O/c13-7-8-3-1-4-9-11(8)15-12(14-9)10-5-2-6-16-10/h1-6H,7,13H2,(H,14,15) |
| InChIKey | NUFZSHWBUWVOAD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |