C17H14N4 — CID 104721160
(2-isoquinolin-1-yl-1H-benzimidazol-4-yl)methanamine (PubChem CID 104721160) has the molecular formula C17H14N4 and a molecular weight of 274.33 g/mol. Its IUPAC name is (2-isoquinolin-1-yl-1H-benzimidazol-4-yl)methanamine.
| Compound Name | (2-isoquinolin-1-yl-1H-benzimidazol-4-yl)methanamine |
|---|---|
| PubChem CID | 104721160 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2-isoquinolin-1-yl-1H-benzimidazol-4-yl)methanamine |
| SMILES | NCc1cccc2[nH]c(-c3nccc4ccccc34)nc12 |
| InChI | InChI=1S/C17H14N4/c18-10-12-5-3-7-14-15(12)21-17(20-14)16-13-6-2-1-4-11(13)8-9-19-16/h1-9H,10,18H2,(H,20,21) |
| InChIKey | UFSJAXGWAOOSOE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |