C14H11F2N3 — CID 104721059
[2-(3,5-difluorophenyl)-1H-benzimidazol-4-yl]methanamine (PubChem CID 104721059) has the molecular formula C14H11F2N3 and a molecular weight of 259.26 g/mol. Its IUPAC name is [2-(3,5-difluorophenyl)-1H-benzimidazol-4-yl]methanamine.
| Compound Name | [2-(3,5-difluorophenyl)-1H-benzimidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 104721059 |
| Molecular Formula | C14H11F2N3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | [2-(3,5-difluorophenyl)-1H-benzimidazol-4-yl]methanamine |
| SMILES | NCc1cccc2[nH]c(-c3cc(F)cc(F)c3)nc12 |
| InChI | InChI=1S/C14H11F2N3/c15-10-4-9(5-11(16)6-10)14-18-12-3-1-2-8(7-17)13(12)19-14/h1-6H,7,17H2,(H,18,19) |
| InChIKey | OCCQTZSZJIJSMV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |