C24H18LaN3O9 — CID 42644911
lanthanum(3+);4-methyl-8-[2-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]ethyliminomethyl]-2-oxochromen-7-olate;nitrate (PubChem CID 42644911) has the molecular formula C24H18LaN3O9 and a molecular weight of 631.33 g/mol. Its IUPAC name is lanthanum(3+);4-methyl-8-[2-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]ethyliminomethyl]-2-oxochromen-7-olate;nitrate.
| Compound Name | lanthanum(3+);4-methyl-8-[2-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]ethyliminomethyl]-2-oxochromen-7-olate;nitrate |
|---|---|
| PubChem CID | 42644911 |
| Molecular Formula | C24H18LaN3O9 |
| Molecular Weight | 631.33 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | lanthanum(3+);4-methyl-8-[2-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]ethyliminomethyl]-2-oxochromen-7-olate;nitrate |
| SMILES | Cc1cc(=O)oc2c(/C=N\CC/N=C/c3c([O-])ccc4c(C)cc(=O)oc34)c([O-])ccc12.O=[N+]([O-])[O-].[La+3] |
| InChI | InChI=1S/C24H20N2O6.La.NO3/c1-13-9-21(29)31-23-15(13)3-5-19(27)17(23)11-25-7-8-26-12-18-20(28)6-4-16-14(2)10-22(30)32-24(16)18;;2-1(3)4/h3-6,9-12,27-28H,7-8H2,1-2H3;;/q;+3;-1/p-2/b25-11-,26-12+;; |
| InChIKey | GVFQTKKSWMAEMV-HCPIHVLNSA-L |
| XLogP | 1.96 |
| TPSA | 197.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|