C16H14N4NiO3S — CID 25187056
4-methyl-2-oxo-8-[(E)-(3-propyl-5-sulfido-1,2,4-triazol-4-yl)iminomethyl]chromen-7-olate;nickel(2+) (PubChem CID 25187056) has the molecular formula C16H14N4NiO3S and a molecular weight of 401.07 g/mol. Its IUPAC name is 4-methyl-2-oxo-8-[(E)-(3-propyl-5-sulfido-1,2,4-triazol-4-yl)iminomethyl]chromen-7-olate;nickel(2+).
| Compound Name | 4-methyl-2-oxo-8-[(E)-(3-propyl-5-sulfido-1,2,4-triazol-4-yl)iminomethyl]chromen-7-olate;nickel(2+) |
|---|---|
| PubChem CID | 25187056 |
| Molecular Formula | C16H14N4NiO3S |
| Molecular Weight | 401.07 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 4-methyl-2-oxo-8-[(E)-(3-propyl-5-sulfido-1,2,4-triazol-4-yl)iminomethyl]chromen-7-olate;nickel(2+) |
| SMILES | CCCc1nnc([S-])n1/N=C/c1c([O-])ccc2c(C)cc(=O)oc12.[Ni+2] |
| InChI | InChI=1S/C16H16N4O3S.Ni/c1-3-4-13-18-19-16(24)20(13)17-8-11-12(21)6-5-10-9(2)7-14(22)23-15(10)11;/h5-8,21H,3-4H2,1-2H3,(H,19,24);/q;+2/p-2/b17-8+; |
| InChIKey | JAORYIFFPJNJKZ-XIDBHWPPSA-L |
| XLogP | 1.50 |
| TPSA | 96.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.07 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|