C24H22Cl4CuN8S2 — CID 66559367
copper bis(4-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-propyl-1,2,4-triazole-3-thiolate) (PubChem CID 66559367) has the molecular formula C24H22Cl4CuN8S2 and a molecular weight of 691.99 g/mol. Its IUPAC name is copper bis(4-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-propyl-1,2,4-triazole-3-thiolate).
| Compound Name | copper bis(4-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-propyl-1,2,4-triazole-3-thiolate) |
|---|---|
| PubChem CID | 66559367 |
| Molecular Formula | C24H22Cl4CuN8S2 |
| Molecular Weight | 691.99 g/mol |
| Exact Mass | 688.95 |
| IUPAC Name | copper bis(4-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-propyl-1,2,4-triazole-3-thiolate) |
| SMILES | CCCc1nnc([S-])n1/N=C/c1ccc(Cl)cc1Cl.CCCc1nnc([S-])n1/N=C/c1ccc(Cl)cc1Cl.[Cu+2] |
| InChI | InChI=1S/2C12H12Cl2N4S.Cu/c2*1-2-3-11-16-17-12(19)18(11)15-7-8-4-5-9(13)6-10(8)14;/h2*4-7H,2-3H2,1H3,(H,17,19);/q;;+2/p-2/b2*15-7+; |
| InChIKey | VPTYUZPJULISFM-WCMIZXEPSA-L |
| XLogP | 6.65 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.99 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|