C19H18ClN5O2S — CID 6892217
(E)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(2-nitrophenyl)methanimine (PubChem CID 6892217) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is (E)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(2-nitrophenyl)methanimine.
| Compound Name | (E)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(2-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 6892217 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (E)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(2-nitrophenyl)methanimine |
| SMILES | CCCc1nnc(SCc2ccc(Cl)cc2)n1/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18ClN5O2S/c1-2-5-18-22-23-19(28-13-14-8-10-16(20)11-9-14)24(18)21-12-15-6-3-4-7-17(15)25(26)27/h3-4,6-12H,2,5,13H2,1H3/b21-12+ |
| InChIKey | UWWSBZPQUIKXNY-CIAFOILYSA-N |
| XLogP | 4.97 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|