C16H11ClN4O2S2 — CID 45140906
(E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(2-nitrophenyl)methanimine (PubChem CID 45140906) has the molecular formula C16H11ClN4O2S2 and a molecular weight of 390.88 g/mol. Its IUPAC name is (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(2-nitrophenyl)methanimine.
| Compound Name | (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(2-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 45140906 |
| Molecular Formula | C16H11ClN4O2S2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | (E)-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(2-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccccc1/C=N/c1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H11ClN4O2S2/c17-13-7-5-11(6-8-13)10-24-16-20-19-15(25-16)18-9-12-3-1-2-4-14(12)21(22)23/h1-9H,10H2/b18-9+ |
| InChIKey | KUZDXOVOGHCISW-GIJQJNRQSA-N |
| XLogP | 5.14 |
| TPSA | 81.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|