C18H12N6O4S2 — CID 137169004
2-[(E)-[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol (PubChem CID 137169004) has the molecular formula C18H12N6O4S2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[(E)-[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol.
| Compound Name | 2-[(E)-[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137169004 |
| Molecular Formula | C18H12N6O4S2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[(E)-[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(CSc3nnc(/N=C/c4ccccc4O)s3)o2)cc1 |
| InChI | InChI=1S/C18H12N6O4S2/c25-14-4-2-1-3-12(14)9-19-17-22-23-18(30-17)29-10-15-20-21-16(28-15)11-5-7-13(8-6-11)24(26)27/h1-9,25H,10H2/b19-9+ |
| InChIKey | HLUOKXKIHMBNMQ-DJKKODMXSA-N |
| XLogP | 4.24 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|