C16H16N6O4S3 — CID 30012375
2-[[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 30012375) has the molecular formula C16H16N6O4S3 and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-[[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 30012375 |
| Molecular Formula | C16H16N6O4S3 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-[[5-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nnc(SCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)s1 |
| InChI | InChI=1S/C16H16N6O4S3/c1-2-7-17-12(23)8-27-15-20-21-16(29-15)28-9-13-18-19-14(26-13)10-3-5-11(6-4-10)22(24)25/h3-6H,2,7-9H2,1H3,(H,17,23) |
| InChIKey | HVSKUTRYVMTKMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|