C18H24N6O5 — CID 55432550
N-(2-methoxyethyl)-2-[4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide (PubChem CID 55432550) has the molecular formula C18H24N6O5 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55432550 |
| Molecular Formula | C18H24N6O5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide |
| SMILES | COCCNC(=O)CN1CCN(Cc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)CC1 |
| InChI | InChI=1S/C18H24N6O5/c1-28-11-6-19-16(25)12-22-7-9-23(10-8-22)13-17-20-21-18(29-17)14-2-4-15(5-3-14)24(26)27/h2-5H,6-13H2,1H3,(H,19,25) |
| InChIKey | AGBTXXQQILCFAJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|