C16H21N5O4S — CID 9094997
3-(2-methoxyethyl)-1-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-propan-2-ylthiourea (PubChem CID 9094997) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-propan-2-ylthiourea.
| Compound Name | 3-(2-methoxyethyl)-1-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 9094997 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-(2-methoxyethyl)-1-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-propan-2-ylthiourea |
| SMILES | COCCNC(=S)N(Cc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)C(C)C |
| InChI | InChI=1S/C16H21N5O4S/c1-11(2)20(16(26)17-8-9-24-3)10-14-18-19-15(25-14)12-4-6-13(7-5-12)21(22)23/h4-7,11H,8-10H2,1-3H3,(H,17,26) |
| InChIKey | AXWKGUFOZWUVDK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|