C18H27N6O3S+ — CID 9095028
dimethyl-[3-[[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-propan-2-ylcarbamothioyl]amino]propyl]azanium (PubChem CID 9095028) has the molecular formula C18H27N6O3S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is dimethyl-[3-[[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-propan-2-ylcarbamothioyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-propan-2-ylcarbamothioyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9095028 |
| Molecular Formula | C18H27N6O3S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | dimethyl-[3-[[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl-propan-2-ylcarbamothioyl]amino]propyl]azanium |
| SMILES | CC(C)N(Cc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)C(=S)NCCC[NH+](C)C |
| InChI | InChI=1S/C18H26N6O3S/c1-13(2)23(18(28)19-10-5-11-22(3)4)12-16-20-21-17(27-16)14-6-8-15(9-7-14)24(25)26/h6-9,13H,5,10-12H2,1-4H3,(H,19,28)/p+1 |
| InChIKey | QCFBPOHBMOEAHJ-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|