C19H18N4O8S — CID 55323817
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 55323817) has the molecular formula C19H18N4O8S and a molecular weight of 462.44 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55323817 |
| Molecular Formula | C19H18N4O8S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C19H18N4O8S/c1-12(22-32(27,28)16-9-7-15(29-2)8-10-16)19(24)30-11-17-20-21-18(31-17)13-3-5-14(6-4-13)23(25)26/h3-10,12,22H,11H2,1-2H3 |
| InChIKey | NTFASZGXGRLMCH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|