C23H25N5O4 — CID 30803811
[4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 30803811) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is [4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 30803811 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1ccc(C(=O)N2CCN(Cc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)CC2)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-16(2)17-3-5-19(6-4-17)23(29)27-13-11-26(12-14-27)15-21-24-25-22(32-21)18-7-9-20(10-8-18)28(30)31/h3-10,16H,11-15H2,1-2H3 |
| InChIKey | BATSTVVVAVORED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|